What isomerism is butenedioic acid?
What isomerism is butenedioic acid?
Its chemical formula is HO2CCH=CHCO2H. Maleic acid is the cis-isomer of butenedioic acid, whereas fumaric acid is the trans-isomer….CHEBI:18300.
| Synonyms | Sources |
|---|---|
| cis-but-2-enedioic acid | IUPAC |
| cis-Butenedioic acid | KEGG COMPOUND |
| H2male | IUPAC |
| Maleic acid | KEGG COMPOUND |
What is butenedioic acid?
A molecular entity capable of donating a hydron to an acceptor (Br o nsted base). (via oxoacid ) Related Structures. butenedioic acid is a Functional Parent of. enol-oxaloacetic acid.
What are the two PKAS of maleic acid?
Maleic acid or cis-butenedioic acid is an organic compound that is a dicarboxylic acid, a molecule with two carboxyl groups. Its chemical formula is HO2CCH=CHCO2H….Maleic acid.
| Names | |
|---|---|
| SMILES O=C(O)\C=C/C(=O)O | |
| Properties | |
| Chemical formula | C4H4O4 |
| Molar mass | 116.072 g·mol−1 |
What is the chemical formula of butenedioic acid?
C4H4O4Fumaric acid / Formula
What are carboxylic acids?
A Carboxylic Acid is an organic compound containing a carboxyl functional group. They occur widely in nature and are also synthetically manufactured by humans. Upon deprotonation, carboxylic acids yield a carboxylate anion with the general formula R-COO–, which can form a variety of useful salts such as soaps.
What is the chemical name of tartaric acid?
dihydroxybutanedioic acid
tartaric acid, also called dihydroxybutanedioic acid, a dicarboxylic acid, one of the most widely distributed of plant acids, with a number of food and industrial uses.
How many PKAS does malic acid have?
Malic acid is found mostly in unripe fruits. Malic acid has two stereoisomeric forms (L- and D-enantiomers), though only the L-isomer exists naturally….Structure for FDB008114 (Malic acid)
| Property | Value | Source |
|---|---|---|
| logP | -0.87 | ALOGPS |
| logP | -1.1 | ChemAxon |
| logS | 0.21 | ALOGPS |
| pKa (Strongest Acidic) | 3.2 | ChemAxon |
What isomerism is shown by maleic acid?
Maleic acid and fumaric acid exhibits geometric isomerism.
What is the Iupac name of maleic acid?
| IUPAC Name | (Z)-but-2-enedioic acid |
|---|---|
| Alternative Names | maleic acid cis-butenedioic acid |
| Molecular Formula | C4H4O4 |
| Molar Mass | 116.072 g/mol |
| InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1- |
What is the structure of fumaric acid?
How many optical isomers does tartaric acid have?
Four forms of tartaric acid are known, of which two are optically active and two are optically inactive. The two optically active forms are mirror images of each other but not superimposable, that is, they are Enantiomers.